C25H35N5O8S — CID 176706887
2-[4-[2-[bis(carboxymethyl)amino]-4-(4-thiocyanatophenyl)butyl]-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 176706887) has the molecular formula C25H35N5O8S and a molecular weight of 565.65 g/mol. Its IUPAC name is 2-[4-[2-[bis(carboxymethyl)amino]-4-(4-thiocyanatophenyl)butyl]-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[bis(carboxymethyl)amino]-4-(4-thiocyanatophenyl)butyl]-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 176706887 |
| Molecular Formula | C25H35N5O8S |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 2-[4-[2-[bis(carboxymethyl)amino]-4-(4-thiocyanatophenyl)butyl]-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | N#CSc1ccc(CCC(CN2CCN(CC(=O)O)CCN(CC(=O)O)CC2)N(CC(=O)O)CC(=O)O)cc1 |
| InChI | InChI=1S/C25H35N5O8S/c26-18-39-21-5-2-19(3-6-21)1-4-20(30(16-24(35)36)17-25(37)38)13-27-7-9-28(14-22(31)32)11-12-29(10-8-27)15-23(33)34/h2-3,5-6,20H,1,4,7-17H2,(H,31,32)(H,33,34)(H,35,36)(H,37,38) |
| InChIKey | MQVFGLDOIIIWIS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 185.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|