C26H34N4O10S — CID 178091827
2-[[(1R)-3-[bis(carboxymethyl)amino]cyclohexyl]-[(2R)-2-[bis(carboxymethyl)amino]-3-(4-thiocyanatophenyl)propyl]amino]acetic acid (PubChem CID 178091827) has the molecular formula C26H34N4O10S and a molecular weight of 594.64 g/mol. Its IUPAC name is 2-[[(1R)-3-[bis(carboxymethyl)amino]cyclohexyl]-[(2R)-2-[bis(carboxymethyl)amino]-3-(4-thiocyanatophenyl)propyl]amino]acetic acid.
| Compound Name | 2-[[(1R)-3-[bis(carboxymethyl)amino]cyclohexyl]-[(2R)-2-[bis(carboxymethyl)amino]-3-(4-thiocyanatophenyl)propyl]amino]acetic acid |
|---|---|
| PubChem CID | 178091827 |
| Molecular Formula | C26H34N4O10S |
| Molecular Weight | 594.64 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | 2-[[(1R)-3-[bis(carboxymethyl)amino]cyclohexyl]-[(2R)-2-[bis(carboxymethyl)amino]-3-(4-thiocyanatophenyl)propyl]amino]acetic acid |
| SMILES | N#CSc1ccc(C[C@H](CN(CC(=O)O)[C@@H]2CCCC(N(CC(=O)O)CC(=O)O)C2)N(CC(=O)O)CC(=O)O)cc1 |
| InChI | InChI=1S/C26H34N4O10S/c27-16-41-21-6-4-17(5-7-21)8-20(30(14-25(37)38)15-26(39)40)10-28(11-22(31)32)18-2-1-3-19(9-18)29(12-23(33)34)13-24(35)36/h4-7,18-20H,1-3,8-15H2,(H,31,32)(H,33,34)(H,35,36)(H,37,38)(H,39,40)/t18-,19?,20-/m1/s1 |
| InChIKey | UGFUAOZLHXUGDK-YSSMNDQQSA-N |
| XLogP | 0.81 |
| TPSA | 220.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.64 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|