C25H34N4O12 — CID 15338669
2-[[2-[bis(carboxymethyl)amino]cyclohexyl]-[2-[bis(carboxymethyl)amino]-3-(4-nitrophenyl)propyl]amino]acetic acid (PubChem CID 15338669) has the molecular formula C25H34N4O12 and a molecular weight of 582.56 g/mol. Its IUPAC name is 2-[[2-[bis(carboxymethyl)amino]cyclohexyl]-[2-[bis(carboxymethyl)amino]-3-(4-nitrophenyl)propyl]amino]acetic acid.
| Compound Name | 2-[[2-[bis(carboxymethyl)amino]cyclohexyl]-[2-[bis(carboxymethyl)amino]-3-(4-nitrophenyl)propyl]amino]acetic acid |
|---|---|
| PubChem CID | 15338669 |
| Molecular Formula | C25H34N4O12 |
| Molecular Weight | 582.56 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | 2-[[2-[bis(carboxymethyl)amino]cyclohexyl]-[2-[bis(carboxymethyl)amino]-3-(4-nitrophenyl)propyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(Cc1ccc([N+](=O)[O-])cc1)CN(CC(=O)O)C1CCCCC1N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C25H34N4O12/c30-21(31)11-26(12-22(32)33)18(9-16-5-7-17(8-6-16)29(40)41)10-27(13-23(34)35)19-3-1-2-4-20(19)28(14-24(36)37)15-25(38)39/h5-8,18-20H,1-4,9-15H2,(H,30,31)(H,32,33)(H,34,35)(H,36,37)(H,38,39) |
| InChIKey | WUGZTYZQQOUTNQ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 239.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.56 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|