C26H27N5O5S2 — CID 144552854
2-[4-[carboxy-(4-thiocyanatophenyl)methyl]-7-(2-oxoethyl)-1,4,7-triazonan-1-yl]-2-(4-thiocyanatophenyl)acetic acid (PubChem CID 144552854) has the molecular formula C26H27N5O5S2 and a molecular weight of 553.67 g/mol. Its IUPAC name is 2-[4-[carboxy-(4-thiocyanatophenyl)methyl]-7-(2-oxoethyl)-1,4,7-triazonan-1-yl]-2-(4-thiocyanatophenyl)acetic acid.
| Compound Name | 2-[4-[carboxy-(4-thiocyanatophenyl)methyl]-7-(2-oxoethyl)-1,4,7-triazonan-1-yl]-2-(4-thiocyanatophenyl)acetic acid |
|---|---|
| PubChem CID | 144552854 |
| Molecular Formula | C26H27N5O5S2 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 2-[4-[carboxy-(4-thiocyanatophenyl)methyl]-7-(2-oxoethyl)-1,4,7-triazonan-1-yl]-2-(4-thiocyanatophenyl)acetic acid |
| SMILES | N#CSc1ccc(C(C(=O)O)N2CCN(CC=O)CCN(C(C(=O)O)c3ccc(SC#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H27N5O5S2/c27-17-37-21-5-1-19(2-6-21)23(25(33)34)30-11-9-29(15-16-32)10-12-31(14-13-30)24(26(35)36)20-3-7-22(8-4-20)38-18-28/h1-8,16,23-24H,9-15H2,(H,33,34)(H,35,36) |
| InChIKey | ZAJONIQSGSSJMV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 148.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|