C16H29N5O7 — CID 170576623
2-amino-2-[4,7-bis(carboxymethyl)-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 170576623) has the molecular formula C16H29N5O7 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-amino-2-[4,7-bis(carboxymethyl)-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-amino-2-[4,7-bis(carboxymethyl)-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 170576623 |
| Molecular Formula | C16H29N5O7 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 2-amino-2-[4,7-bis(carboxymethyl)-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | NC(C(=O)O)N1CCN(CC=O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C16H29N5O7/c17-15(16(27)28)21-7-5-18(9-10-22)1-2-19(11-13(23)24)3-4-20(6-8-21)12-14(25)26/h10,15H,1-9,11-12,17H2,(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | JUIYLWJSZYDAGY-UHFFFAOYSA-N |
| XLogP | -3.05 |
| TPSA | 167.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|