C13H22N4O6 — CID 177001576
2-[7-(carboxymethyl)-3,5-bis(2-oxoethyl)-1,3,5,7-tetrazonan-1-yl]acetic acid (PubChem CID 177001576) has the molecular formula C13H22N4O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is 2-[7-(carboxymethyl)-3,5-bis(2-oxoethyl)-1,3,5,7-tetrazonan-1-yl]acetic acid.
| Compound Name | 2-[7-(carboxymethyl)-3,5-bis(2-oxoethyl)-1,3,5,7-tetrazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 177001576 |
| Molecular Formula | C13H22N4O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-[7-(carboxymethyl)-3,5-bis(2-oxoethyl)-1,3,5,7-tetrazonan-1-yl]acetic acid |
| SMILES | O=CCN1CN(CC(=O)O)CCN(CC(=O)O)CN(CC=O)C1 |
| InChI | InChI=1S/C13H22N4O6/c18-5-3-16-9-14(7-12(20)21)1-2-15(8-13(22)23)10-17(11-16)4-6-19/h5-6H,1-4,7-11H2,(H,20,21)(H,22,23) |
| InChIKey | QYDICCQBRUEDTE-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|