C14H25KN4O7 — CID 177001575
potassium;2-[7-(carboxymethyl)-3-(2-oxoethyl)-5-(2-oxoethyl)-1,3,5,7-tetrazonan-1-yl]acetic acid;methanol (PubChem CID 177001575) has the molecular formula C14H25KN4O7 and a molecular weight of 400.47 g/mol. Its IUPAC name is potassium;2-[7-(carboxymethyl)-3-(2-oxoethyl)-5-(2-oxoethyl)-1,3,5,7-tetrazonan-1-yl]acetic acid;methanol.
| Compound Name | potassium;2-[7-(carboxymethyl)-3-(2-oxoethyl)-5-(2-oxoethyl)-1,3,5,7-tetrazonan-1-yl]acetic acid;methanol |
|---|---|
| PubChem CID | 177001575 |
| Molecular Formula | C14H25KN4O7 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | potassium;2-[7-(carboxymethyl)-3-(2-oxoethyl)-5-(2-oxoethyl)-1,3,5,7-tetrazonan-1-yl]acetic acid;methanol |
| SMILES | CO.O=[C-]CN1CN(CC(=O)O)CCN(CC(=O)O)CN(CC=O)C1.[K+] |
| InChI | InChI=1S/C13H21N4O6.CH4O.K/c18-5-3-16-9-14(7-12(20)21)1-2-15(8-13(22)23)10-17(11-16)4-6-19;1-2;/h5H,1-4,7-11H2,(H,20,21)(H,22,23);2H,1H3;/q-1;;+1 |
| InChIKey | IOZUMEXJNNMOPS-UHFFFAOYSA-N |
| XLogP | -5.83 |
| TPSA | 141.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | -5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|