C24H42N6O11 — CID 176706959
2-[4,7,10,13-tetrakis(carboxymethyl)-16-(2-oxoethyl)-1,4,7,10,13,16-hexazacyclooctadec-1-yl]acetic acid (PubChem CID 176706959) has the molecular formula C24H42N6O11 and a molecular weight of 590.63 g/mol. Its IUPAC name is 2-[4,7,10,13-tetrakis(carboxymethyl)-16-(2-oxoethyl)-1,4,7,10,13,16-hexazacyclooctadec-1-yl]acetic acid.
| Compound Name | 2-[4,7,10,13-tetrakis(carboxymethyl)-16-(2-oxoethyl)-1,4,7,10,13,16-hexazacyclooctadec-1-yl]acetic acid |
|---|---|
| PubChem CID | 176706959 |
| Molecular Formula | C24H42N6O11 |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | 2-[4,7,10,13-tetrakis(carboxymethyl)-16-(2-oxoethyl)-1,4,7,10,13,16-hexazacyclooctadec-1-yl]acetic acid |
| SMILES | O=CCN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C24H42N6O11/c31-14-13-25-1-3-26(15-20(32)33)5-7-28(17-22(36)37)9-11-30(19-24(40)41)12-10-29(18-23(38)39)8-6-27(4-2-25)16-21(34)35/h14H,1-13,15-19H2,(H,32,33)(H,34,35)(H,36,37)(H,38,39)(H,40,41) |
| InChIKey | KCJKRROUQMQNNO-UHFFFAOYSA-N |
| XLogP | -3.57 |
| TPSA | 223.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|