C24H43N7O10 — CID 158404833
2-[4-(2-amino-2-oxoethyl)-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid;2-[4-(carboxymethyl)-7-(2-oxoethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 158404833) has the molecular formula C24H43N7O10 and a molecular weight of 589.65 g/mol. Its IUPAC name is 2-[4-(2-amino-2-oxoethyl)-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid;2-[4-(carboxymethyl)-7-(2-oxoethyl)-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-(2-amino-2-oxoethyl)-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid;2-[4-(carboxymethyl)-7-(2-oxoethyl)-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 158404833 |
| Molecular Formula | C24H43N7O10 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.31 |
| IUPAC Name | 2-[4-(2-amino-2-oxoethyl)-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid;2-[4-(carboxymethyl)-7-(2-oxoethyl)-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | NC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CC1.O=CCN1CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C12H22N4O5.C12H21N3O5/c13-10(17)7-14-1-3-15(8-11(18)19)5-6-16(4-2-14)9-12(20)21;16-8-7-13-1-3-14(9-11(17)18)5-6-15(4-2-13)10-12(19)20/h1-9H2,(H2,13,17)(H,18,19)(H,20,21);8H,1-7,9-10H2,(H,17,18)(H,19,20) |
| InChIKey | GYNYFWPEEQKWSX-UHFFFAOYSA-N |
| XLogP | -4.17 |
| TPSA | 228.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | -4.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|