C13H22N4O5 — CID 166876851
2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid (PubChem CID 166876851) has the molecular formula C13H22N4O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid.
| Compound Name | 2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid |
|---|---|
| PubChem CID | 166876851 |
| Molecular Formula | C13H22N4O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid |
| SMILES | O=CCN1CCN(CC=O)CN(CC(=O)O)CN(CC=O)C1 |
| InChI | InChI=1S/C13H22N4O5/c18-6-3-14-1-2-15(4-7-19)11-17(9-13(21)22)12-16(10-14)5-8-20/h6-8H,1-5,9-12H2,(H,21,22) |
| InChIKey | CSRKMHAIBZPFBU-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|