2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid

C13H22N4O5 — CID 166876851

IUPAC2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid
SMILESO=CCN1CCN(CC=O)CN(CC(=O)O)CN(CC=O)C1
InChIInChI=1S/C13H22N4O5/c18-6-3-14-1-2-15(4-7-19)11-17(9-13(21)22)12-16(10-14)5-8-20/h6-8H,1-5,9-12H2,(H,21,22)
InChIKeyCSRKMHAIBZPFBU-UHFFFAOYSA-N
MW314.34 g/mol
LogP-2.24
Rot. Bonds8

About 2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid

2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid (PubChem CID 166876851) has the molecular formula C13H22N4O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid.

Molecular Properties

Compound Name2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid
PubChem CID166876851
Molecular FormulaC13H22N4O5
Molecular Weight314.34 g/mol
Exact Mass314.16
IUPAC Name2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid
SMILESO=CCN1CCN(CC=O)CN(CC(=O)O)CN(CC=O)C1
InChIInChI=1S/C13H22N4O5/c18-6-3-14-1-2-15(4-7-19)11-17(9-13(21)22)12-16(10-14)5-8-20/h6-8H,1-5,9-12H2,(H,21,22)
InChIKeyCSRKMHAIBZPFBU-UHFFFAOYSA-N
XLogP-2.24
TPSA101.47 Ų
H-Bond Donors1
H-Bond Acceptors8
Rotatable Bonds8
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.34
LogP ≤ 5-2.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid?
The IUPAC name of 2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid (CID 166876851) is 2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid.
What is the SMILES notation for 2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid?
The canonical SMILES for 2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid is O=CCN1CCN(CC=O)CN(CC(=O)O)CN(CC=O)C1.
What is the InChIKey of 2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid?
The InChIKey is CSRKMHAIBZPFBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O5/c18-6-3-14-1-2-15(4-7-19)11-17(9-13(21)22)12-16(10-14)5-8-20/h6-8H,1-5,9-12H2,(H,21,22).
What are the key properties of 2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid?
2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid has a molecular weight of 314.34 g/mol, XLogP of -2.24, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,5,7-tris(2-oxoethyl)-1,3,5,7-tetrazonan-3-yl]acetic acid is sourced from PubChem (CID 166876851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).