C17H30N4O7 — CID 164874677
2-[7,10-bis(carboxymethyl)-6-methyl-4-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 164874677) has the molecular formula C17H30N4O7 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-[7,10-bis(carboxymethyl)-6-methyl-4-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[7,10-bis(carboxymethyl)-6-methyl-4-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 164874677 |
| Molecular Formula | C17H30N4O7 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-[7,10-bis(carboxymethyl)-6-methyl-4-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC1CN(CC=O)CCN(CC(=O)O)CCN(CC(=O)O)CCN1CC(=O)O |
| InChI | InChI=1S/C17H30N4O7/c1-14-10-20(8-9-22)5-4-18(11-15(23)24)2-3-19(12-16(25)26)6-7-21(14)13-17(27)28/h9,14H,2-8,10-13H2,1H3,(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | ISDDSNCWGHDJSQ-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 141.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|