C18H32N4O8 — CID 145309569
2-[4,7,10-tris(carboxymethyl)-9-methyl-1,4,7,10-tetrazacyclotridec-1-yl]acetic acid (PubChem CID 145309569) has the molecular formula C18H32N4O8 and a molecular weight of 432.47 g/mol. Its IUPAC name is 2-[4,7,10-tris(carboxymethyl)-9-methyl-1,4,7,10-tetrazacyclotridec-1-yl]acetic acid.
| Compound Name | 2-[4,7,10-tris(carboxymethyl)-9-methyl-1,4,7,10-tetrazacyclotridec-1-yl]acetic acid |
|---|---|
| PubChem CID | 145309569 |
| Molecular Formula | C18H32N4O8 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 2-[4,7,10-tris(carboxymethyl)-9-methyl-1,4,7,10-tetrazacyclotridec-1-yl]acetic acid |
| SMILES | CC1CN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CCCN1CC(=O)O |
| InChI | InChI=1S/C18H32N4O8/c1-14-9-21(12-17(27)28)8-7-20(11-16(25)26)6-5-19(10-15(23)24)3-2-4-22(14)13-18(29)30/h14H,2-13H2,1H3,(H,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | ZGGUQDXBNDGENN-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |