C22H40N4O8 — CID 129117851
2-[4,8,11-tris(carboxymethyl)-6-(2-methylpropyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetic acid (PubChem CID 129117851) has the molecular formula C22H40N4O8 and a molecular weight of 488.58 g/mol. Its IUPAC name is 2-[4,8,11-tris(carboxymethyl)-6-(2-methylpropyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetic acid.
| Compound Name | 2-[4,8,11-tris(carboxymethyl)-6-(2-methylpropyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetic acid |
|---|---|
| PubChem CID | 129117851 |
| Molecular Formula | C22H40N4O8 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 2-[4,8,11-tris(carboxymethyl)-6-(2-methylpropyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetic acid |
| SMILES | CC(C)CC1CN(CC(=O)O)CCN(CC(=O)O)CCCN(CC(=O)O)CCN(CC(=O)O)C1 |
| InChI | InChI=1S/C22H40N4O8/c1-17(2)10-18-11-25(15-21(31)32)8-6-23(13-19(27)28)4-3-5-24(14-20(29)30)7-9-26(12-18)16-22(33)34/h17-18H,3-16H2,1-2H3,(H,27,28)(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | JKSPXTDLNBCQDE-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |