C19H34N4O8 — CID 171599562
(2R)-3-methyl-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanoic acid (PubChem CID 171599562) has the molecular formula C19H34N4O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is (2R)-3-methyl-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanoic acid |
|---|---|
| PubChem CID | 171599562 |
| Molecular Formula | C19H34N4O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (2R)-3-methyl-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanoic acid |
| SMILES | CC(C)[C@H](C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C19H34N4O8/c1-14(2)18(19(30)31)23-9-7-21(12-16(26)27)5-3-20(11-15(24)25)4-6-22(8-10-23)13-17(28)29/h14,18H,3-13H2,1-2H3,(H,24,25)(H,26,27)(H,28,29)(H,30,31)/t18-/m1/s1 |
| InChIKey | BHIFPGPOHFPPCR-GOSISDBHSA-N |
| XLogP | -1.43 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |