C20H38N4O8 — CID 177168560
2-[4,10-bis(carboxymethyl)-7-(3-methylbutan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;formic acid (PubChem CID 177168560) has the molecular formula C20H38N4O8 and a molecular weight of 462.54 g/mol. Its IUPAC name is 2-[4,10-bis(carboxymethyl)-7-(3-methylbutan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;formic acid.
| Compound Name | 2-[4,10-bis(carboxymethyl)-7-(3-methylbutan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;formic acid |
|---|---|
| PubChem CID | 177168560 |
| Molecular Formula | C20H38N4O8 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 2-[4,10-bis(carboxymethyl)-7-(3-methylbutan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;formic acid |
| SMILES | CC(C)C(C)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1.O=CO |
| InChI | InChI=1S/C19H36N4O6.CH2O2/c1-15(2)16(3)23-10-8-21(13-18(26)27)6-4-20(12-17(24)25)5-7-22(9-11-23)14-19(28)29;2-1-3/h15-16H,4-14H2,1-3H3,(H,24,25)(H,26,27)(H,28,29);1H,(H,2,3) |
| InChIKey | DYZAOXWXQZBNES-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|