C15H27N4O8P — CID 87762113
2-[4,10-bis(carboxymethyl)-7-[hydroxy(phosphoroso)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 87762113) has the molecular formula C15H27N4O8P and a molecular weight of 422.38 g/mol. Its IUPAC name is 2-[4,10-bis(carboxymethyl)-7-[hydroxy(phosphoroso)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,10-bis(carboxymethyl)-7-[hydroxy(phosphoroso)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 87762113 |
| Molecular Formula | C15H27N4O8P |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-[4,10-bis(carboxymethyl)-7-[hydroxy(phosphoroso)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=PC(O)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C15H27N4O8P/c20-12(21)9-16-1-3-17(10-13(22)23)5-7-19(15(26)28-27)8-6-18(4-2-16)11-14(24)25/h15,26H,1-11H2,(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | UJNXJUHYVFHVAT-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|