C15H28N4O8P+ — CID 173153853
[hydroxy-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]methyl]-oxophosphanium (PubChem CID 173153853) has the molecular formula C15H28N4O8P+ and a molecular weight of 423.38 g/mol. Its IUPAC name is [hydroxy-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]methyl]-oxophosphanium.
| Compound Name | [hydroxy-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]methyl]-oxophosphanium |
|---|---|
| PubChem CID | 173153853 |
| Molecular Formula | C15H28N4O8P+ |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [hydroxy-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]methyl]-oxophosphanium |
| SMILES | O=[PH+]C(O)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C15H27N4O8P/c20-12(21)9-16-1-3-17(10-13(22)23)5-7-19(15(26)28-27)8-6-18(4-2-16)11-14(24)25/h15,26H,1-11H2,(H,20,21)(H,22,23)(H,24,25)/p+1 |
| InChIKey | UJNXJUHYVFHVAT-UHFFFAOYSA-O |
| XLogP | -2.24 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|