C15H27BN4O6 — CID 157263533
CID 157263533 (PubChem CID 157263533) has the molecular formula C15H27BN4O6 and a molecular weight of 370.22 g/mol.
| Compound Name | CID 157263533 |
|---|---|
| PubChem CID | 157263533 |
| Molecular Formula | C15H27BN4O6 |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | — |
| SMILES | [B]CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C15H27BN4O6/c16-12-20-7-5-18(10-14(23)24)3-1-17(9-13(21)22)2-4-19(6-8-20)11-15(25)26/h1-12H2,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | PXMVMURTGNXLNK-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|