C19H34N4O8 — CID 168845950
2-[4,10-bis(carboxymethyl)-7-(1-formyloxybutyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 168845950) has the molecular formula C19H34N4O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-[4,10-bis(carboxymethyl)-7-(1-formyloxybutyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,10-bis(carboxymethyl)-7-(1-formyloxybutyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 168845950 |
| Molecular Formula | C19H34N4O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 2-[4,10-bis(carboxymethyl)-7-(1-formyloxybutyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CCCC(OC=O)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C19H34N4O8/c1-2-3-16(31-15-24)23-10-8-21(13-18(27)28)6-4-20(12-17(25)26)5-7-22(9-11-23)14-19(29)30/h15-16H,2-14H2,1H3,(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | DLMHWYVPAPRMGV-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 151.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|