C19H33N3O7 — CID 164739015
2-[4-(1-formyloxy-5,5-dimethyl-4-oxohexyl)-7-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 164739015) has the molecular formula C19H33N3O7 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[4-(1-formyloxy-5,5-dimethyl-4-oxohexyl)-7-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-(1-formyloxy-5,5-dimethyl-4-oxohexyl)-7-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 164739015 |
| Molecular Formula | C19H33N3O7 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 2-[4-(1-formyloxy-5,5-dimethyl-4-oxohexyl)-7-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | CC(C)(C)C(=O)CCC(OC=O)N1CCN(COC=O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C19H33N3O7/c1-19(2,3)16(25)4-5-17(29-15-24)22-10-8-20(12-18(26)27)6-7-21(9-11-22)13-28-14-23/h14-15,17H,4-13H2,1-3H3,(H,26,27) |
| InChIKey | SIQMABVHEVYVGW-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|