C16H30N4O5 — CID 58076527
2-[4-[[formyl(2-methylpropyl)amino]methyl]-7-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 58076527) has the molecular formula C16H30N4O5 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-[4-[[formyl(2-methylpropyl)amino]methyl]-7-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-[[formyl(2-methylpropyl)amino]methyl]-7-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 58076527 |
| Molecular Formula | C16H30N4O5 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 2-[4-[[formyl(2-methylpropyl)amino]methyl]-7-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | CC(C)CN(C=O)CN1CCN(COC=O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C16H30N4O5/c1-15(2)9-20(12-21)11-18-5-3-17(10-16(23)24)4-7-19(8-6-18)13-25-14-22/h12,14-15H,3-11,13H2,1-2H3,(H,23,24) |
| InChIKey | BTSHBNXOZBKYCU-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|