C20H34F4N4O4 — CID 177133639
2-[4,10-bis(2-fluoro-2-oxoethyl)-7-(3-methylbutan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl fluoride;formyl fluoride (PubChem CID 177133639) has the molecular formula C20H34F4N4O4 and a molecular weight of 470.51 g/mol. Its IUPAC name is 2-[4,10-bis(2-fluoro-2-oxoethyl)-7-(3-methylbutan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl fluoride;formyl fluoride.
| Compound Name | 2-[4,10-bis(2-fluoro-2-oxoethyl)-7-(3-methylbutan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl fluoride;formyl fluoride |
|---|---|
| PubChem CID | 177133639 |
| Molecular Formula | C20H34F4N4O4 |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 2-[4,10-bis(2-fluoro-2-oxoethyl)-7-(3-methylbutan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl fluoride;formyl fluoride |
| SMILES | CC(C)C(C)N1CCN(CC(=O)F)CCN(CC(=O)F)CCN(CC(=O)F)CC1.O=CF |
| InChI | InChI=1S/C19H33F3N4O3.CHFO/c1-15(2)16(3)26-10-8-24(13-18(21)28)6-4-23(12-17(20)27)5-7-25(9-11-26)14-19(22)29;2-1-3/h15-16H,4-14H2,1-3H3;1H |
| InChIKey | HSIYMSOOZVFSHH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|