C23H40N4O5 — CID 59755006
3-[4,7,10-tris(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]hexane-2,5-dione (PubChem CID 59755006) has the molecular formula C23H40N4O5 and a molecular weight of 452.60 g/mol. Its IUPAC name is 3-[4,7,10-tris(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]hexane-2,5-dione.
| Compound Name | 3-[4,7,10-tris(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]hexane-2,5-dione |
|---|---|
| PubChem CID | 59755006 |
| Molecular Formula | C23H40N4O5 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | 3-[4,7,10-tris(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]hexane-2,5-dione |
| SMILES | CC(=O)CC(C(C)=O)N1CCN(CC(C)=O)CCN(CC(C)=O)CCN(CC(C)=O)CC1 |
| InChI | InChI=1S/C23H40N4O5/c1-18(28)14-23(22(5)32)27-12-10-25(16-20(3)30)8-6-24(15-19(2)29)7-9-26(11-13-27)17-21(4)31/h23H,6-17H2,1-5H3 |
| InChIKey | JPXXVRDULDPMKY-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |