C15H26N3O3Y- — CID 58583102
1-[7-(2-oxopropyl)-4-(2-oxopropyl)-1,4,7-triazonan-1-yl]propan-2-one;yttrium (PubChem CID 58583102) has the molecular formula C15H26N3O3Y- and a molecular weight of 385.30 g/mol. Its IUPAC name is 1-[7-(2-oxopropyl)-4-(2-oxopropyl)-1,4,7-triazonan-1-yl]propan-2-one;yttrium.
| Compound Name | 1-[7-(2-oxopropyl)-4-(2-oxopropyl)-1,4,7-triazonan-1-yl]propan-2-one;yttrium |
|---|---|
| PubChem CID | 58583102 |
| Molecular Formula | C15H26N3O3Y- |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 1-[7-(2-oxopropyl)-4-(2-oxopropyl)-1,4,7-triazonan-1-yl]propan-2-one;yttrium |
| SMILES | CC(=O)[CH-]N1CCN(CC(C)=O)CCN(CC(C)=O)CC1.[Y] |
| InChI | InChI=1S/C15H26N3O3.Y/c1-13(19)10-16-4-6-17(11-14(2)20)8-9-18(7-5-16)12-15(3)21;/h10H,4-9,11-12H2,1-3H3;/q-1; |
| InChIKey | UHNDSUSOLMMWCN-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|