C12H21N3O3 — CID 20775518
2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde (PubChem CID 20775518) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde.
| Compound Name | 2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 20775518 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde |
| SMILES | O=CCN1CCN(CC=O)CCN(CC=O)CC1 |
| InChI | InChI=1S/C12H21N3O3/c16-10-7-13-1-2-14(8-11-17)5-6-15(4-3-13)9-12-18/h10-12H,1-9H2 |
| InChIKey | WYUDMYBLARZDME-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|