About 2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde
2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde (PubChem CID 20775518) has the molecular formula C12H21N3O3
and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde |
| PubChem CID | 20775518 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde |
| SMILES | O=CCN1CCN(CC=O)CCN(CC=O)CC1 |
| InChI | InChI=1S/C12H21N3O3/c16-10-7-13-1-2-14(8-11-17)5-6-15(4-3-13)9-12-18/h10-12H,1-9H2 |
| InChIKey | WYUDMYBLARZDME-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde?
The IUPAC name of 2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde (CID 20775518) is 2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde.
What is the SMILES notation for 2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde?
The canonical SMILES for 2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde is O=CCN1CCN(CC=O)CCN(CC=O)CC1.
What is the InChIKey of 2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde?
The InChIKey is WYUDMYBLARZDME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O3/c16-10-7-13-1-2-14(8-11-17)5-6-15(4-3-13)9-12-18/h10-12H,1-9H2.
What are the key properties of 2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde?
2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde has a molecular weight of 255.32 g/mol, XLogP of -1.50, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetaldehyde is sourced from PubChem (CID 20775518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).