C24H39N5O4 — CID 66829151
4-(4-aminophenyl)-2-[11-(carboxymethyl)-1,4,8,11-tetrazabicyclo[6.6.2]hexadecan-4-yl]butanoic acid (PubChem CID 66829151) has the molecular formula C24H39N5O4 and a molecular weight of 461.61 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2-[11-(carboxymethyl)-1,4,8,11-tetrazabicyclo[6.6.2]hexadecan-4-yl]butanoic acid.
| Compound Name | 4-(4-aminophenyl)-2-[11-(carboxymethyl)-1,4,8,11-tetrazabicyclo[6.6.2]hexadecan-4-yl]butanoic acid |
|---|---|
| PubChem CID | 66829151 |
| Molecular Formula | C24H39N5O4 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | 4-(4-aminophenyl)-2-[11-(carboxymethyl)-1,4,8,11-tetrazabicyclo[6.6.2]hexadecan-4-yl]butanoic acid |
| SMILES | Nc1ccc(CCC(C(=O)O)N2CCCN3CCN(CCCN(CC(=O)O)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H39N5O4/c25-21-6-3-20(4-7-21)5-8-22(24(32)33)29-12-2-10-26-13-14-27(17-18-29)9-1-11-28(16-15-26)19-23(30)31/h3-4,6-7,22H,1-2,5,8-19,25H2,(H,30,31)(H,32,33) |
| InChIKey | KQXZDJYWQIYZLP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|