C34H44N6O4S2 — CID 11657593
2-[11-[1-carboxy-3-(4-isothiocyanatophenyl)propyl]-1,4,8,11-tetrazabicyclo[6.6.2]hexadecan-4-yl]-4-(4-isothiocyanatophenyl)butanoic acid (PubChem CID 11657593) has the molecular formula C34H44N6O4S2 and a molecular weight of 664.90 g/mol. Its IUPAC name is 2-[11-[1-carboxy-3-(4-isothiocyanatophenyl)propyl]-1,4,8,11-tetrazabicyclo[6.6.2]hexadecan-4-yl]-4-(4-isothiocyanatophenyl)butanoic acid.
| Compound Name | 2-[11-[1-carboxy-3-(4-isothiocyanatophenyl)propyl]-1,4,8,11-tetrazabicyclo[6.6.2]hexadecan-4-yl]-4-(4-isothiocyanatophenyl)butanoic acid |
|---|---|
| PubChem CID | 11657593 |
| Molecular Formula | C34H44N6O4S2 |
| Molecular Weight | 664.90 g/mol |
| Exact Mass | 664.29 |
| IUPAC Name | 2-[11-[1-carboxy-3-(4-isothiocyanatophenyl)propyl]-1,4,8,11-tetrazabicyclo[6.6.2]hexadecan-4-yl]-4-(4-isothiocyanatophenyl)butanoic acid |
| SMILES | O=C(O)C(CCc1ccc(N=C=S)cc1)N1CCCN2CCN(CCCN(C(CCc3ccc(N=C=S)cc3)C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C34H44N6O4S2/c41-33(42)31(13-7-27-3-9-29(10-4-27)35-25-45)39-17-1-15-37-19-20-38(22-23-39)16-2-18-40(24-21-37)32(34(43)44)14-8-28-5-11-30(12-6-28)36-26-46/h3-6,9-12,31-32H,1-2,7-8,13-24H2,(H,41,42)(H,43,44) |
| InChIKey | INFSDLQQZORRAG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 112.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.90 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|