C21H32N4O3 — CID 60505162
1-(3,5-dimethylpiperidin-1-yl)-2-[4-[2-(4-nitrophenyl)ethyl]piperazin-1-yl]ethanone (PubChem CID 60505162) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperidin-1-yl)-2-[4-[2-(4-nitrophenyl)ethyl]piperazin-1-yl]ethanone.
| Compound Name | 1-(3,5-dimethylpiperidin-1-yl)-2-[4-[2-(4-nitrophenyl)ethyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 60505162 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 1-(3,5-dimethylpiperidin-1-yl)-2-[4-[2-(4-nitrophenyl)ethyl]piperazin-1-yl]ethanone |
| SMILES | CC1CC(C)CN(C(=O)CN2CCN(CCc3ccc([N+](=O)[O-])cc3)CC2)C1 |
| InChI | InChI=1S/C21H32N4O3/c1-17-13-18(2)15-24(14-17)21(26)16-23-11-9-22(10-12-23)8-7-19-3-5-20(6-4-19)25(27)28/h3-6,17-18H,7-16H2,1-2H3 |
| InChIKey | SUBWZQGRUWSTHI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|