C23H28N4O4 — CID 86694464
2-cyclopropyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine (PubChem CID 86694464) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-cyclopropyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine.
| Compound Name | 2-cyclopropyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 86694464 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 2-cyclopropyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine |
| SMILES | O=[N+]([O-])c1ccc(CCN2CCN(CCc3ccc([N+](=O)[O-])cc3)C(C3CC3)C2)cc1 |
| InChI | InChI=1S/C23H28N4O4/c28-26(29)21-7-1-18(2-8-21)11-13-24-15-16-25(23(17-24)20-5-6-20)14-12-19-3-9-22(10-4-19)27(30)31/h1-4,7-10,20,23H,5-6,11-17H2 |
| InChIKey | FUTJIVFKLDPOQM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|