C25H34N4O5 — CID 86694467
2-[(2-methylpropan-2-yl)oxymethyl]-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine (PubChem CID 86694467) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxymethyl]-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine.
| Compound Name | 2-[(2-methylpropan-2-yl)oxymethyl]-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 86694467 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxymethyl]-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine |
| SMILES | CC(C)(C)OCC1CN(CCc2ccc([N+](=O)[O-])cc2)CCN1CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H34N4O5/c1-25(2,3)34-19-24-18-26(14-12-20-4-8-22(9-5-20)28(30)31)16-17-27(24)15-13-21-6-10-23(11-7-21)29(32)33/h4-11,24H,12-19H2,1-3H3 |
| InChIKey | XHHWIDOJQIFJQS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|