C27H53N5O14P4 — CID 20871493
1,4,7,10-tetrakis(dimethoxyphosphorylmethyl)-2-[(4-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododecane (PubChem CID 20871493) has the molecular formula C27H53N5O14P4 and a molecular weight of 795.64 g/mol. Its IUPAC name is 1,4,7,10-tetrakis(dimethoxyphosphorylmethyl)-2-[(4-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1,4,7,10-tetrakis(dimethoxyphosphorylmethyl)-2-[(4-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 20871493 |
| Molecular Formula | C27H53N5O14P4 |
| Molecular Weight | 795.64 g/mol |
| Exact Mass | 795.25 |
| IUPAC Name | 1,4,7,10-tetrakis(dimethoxyphosphorylmethyl)-2-[(4-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododecane |
| SMILES | COP(=O)(CN1CCN(CP(=O)(OC)OC)CCN(CP(=O)(OC)OC)C(Cc2ccc([N+](=O)[O-])cc2)CN(CP(=O)(OC)OC)CC1)OC |
| InChI | InChI=1S/C27H53N5O14P4/c1-39-47(35,40-2)21-28-13-14-29(22-48(36,41-3)42-4)17-18-31(24-50(38,45-7)46-8)27(19-25-9-11-26(12-10-25)32(33)34)20-30(16-15-28)23-49(37,43-5)44-6/h9-12,27H,13-24H2,1-8H3 |
| InChIKey | PXWPVHDLACLGGB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 198.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|