C26H41N5O8 — CID 70822099
2-[4-[1-[bis(carboxymethyl)amino]-7-(4-nitrophenyl)heptan-2-yl]-7-methyl-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 70822099) has the molecular formula C26H41N5O8 and a molecular weight of 551.64 g/mol. Its IUPAC name is 2-[4-[1-[bis(carboxymethyl)amino]-7-(4-nitrophenyl)heptan-2-yl]-7-methyl-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-[1-[bis(carboxymethyl)amino]-7-(4-nitrophenyl)heptan-2-yl]-7-methyl-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 70822099 |
| Molecular Formula | C26H41N5O8 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | 2-[4-[1-[bis(carboxymethyl)amino]-7-(4-nitrophenyl)heptan-2-yl]-7-methyl-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | CN1CCN(CC(=O)O)CCN(C(CCCCCc2ccc([N+](=O)[O-])cc2)CN(CC(=O)O)CC(=O)O)CC1 |
| InChI | InChI=1S/C26H41N5O8/c1-27-11-13-28(18-24(32)33)14-16-30(15-12-27)23(17-29(19-25(34)35)20-26(36)37)6-4-2-3-5-21-7-9-22(10-8-21)31(38)39/h7-10,23H,2-6,11-20H2,1H3,(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | KHLQITOTUFIAAO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 168.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|