C24H36N4O8 — CID 91017510
carbon dioxide;5-[4-(carboxymethyl)-7-methyl-1,4,7-triazonan-1-yl]-8-(4-nitrophenyl)octanoic acid (PubChem CID 91017510) has the molecular formula C24H36N4O8 and a molecular weight of 508.57 g/mol. Its IUPAC name is carbon dioxide;5-[4-(carboxymethyl)-7-methyl-1,4,7-triazonan-1-yl]-8-(4-nitrophenyl)octanoic acid.
| Compound Name | carbon dioxide;5-[4-(carboxymethyl)-7-methyl-1,4,7-triazonan-1-yl]-8-(4-nitrophenyl)octanoic acid |
|---|---|
| PubChem CID | 91017510 |
| Molecular Formula | C24H36N4O8 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | carbon dioxide;5-[4-(carboxymethyl)-7-methyl-1,4,7-triazonan-1-yl]-8-(4-nitrophenyl)octanoic acid |
| SMILES | CN1CCN(CC(=O)O)CCN(C(CCCC(=O)O)CCCc2ccc([N+](=O)[O-])cc2)CC1.O=C=O |
| InChI | InChI=1S/C23H36N4O6.CO2/c1-24-12-14-25(18-23(30)31)15-17-26(16-13-24)20(6-3-7-22(28)29)5-2-4-19-8-10-21(11-9-19)27(32)33;2-1-3/h8-11,20H,2-7,12-18H2,1H3,(H,28,29)(H,30,31); |
| InChIKey | JVZGZNGWTKIILQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 161.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|