C24H42N6O6 — CID 101404714
4-(4-nitrophenyl)-2-[4,7,10-tris(2-hydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanamide (PubChem CID 101404714) has the molecular formula C24H42N6O6 and a molecular weight of 510.64 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-2-[4,7,10-tris(2-hydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanamide.
| Compound Name | 4-(4-nitrophenyl)-2-[4,7,10-tris(2-hydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanamide |
|---|---|
| PubChem CID | 101404714 |
| Molecular Formula | C24H42N6O6 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | 4-(4-nitrophenyl)-2-[4,7,10-tris(2-hydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanamide |
| SMILES | NC(=O)C(CCc1ccc([N+](=O)[O-])cc1)N1CCN(CCO)CCN(CCO)CCN(CCO)CC1 |
| InChI | InChI=1S/C24H42N6O6/c25-24(34)23(6-3-21-1-4-22(5-2-21)30(35)36)29-13-11-27(16-19-32)9-7-26(15-18-31)8-10-28(12-14-29)17-20-33/h1-2,4-5,23,31-33H,3,6-20H2,(H2,25,34) |
| InChIKey | KNXWCLKNRIMSIM-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 159.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|