C29H40GdN6O11+ — CID 159622087
2-[4-(carboxylatomethyl)-7-(carboxymethyl)-10-[2-[cyclopentyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) (PubChem CID 159622087) has the molecular formula C29H40GdN6O11+ and a molecular weight of 805.92 g/mol. Its IUPAC name is 2-[4-(carboxylatomethyl)-7-(carboxymethyl)-10-[2-[cyclopentyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+).
| Compound Name | 2-[4-(carboxylatomethyl)-7-(carboxymethyl)-10-[2-[cyclopentyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) |
|---|---|
| PubChem CID | 159622087 |
| Molecular Formula | C29H40GdN6O11+ |
| Molecular Weight | 805.92 g/mol |
| Exact Mass | 806.20 |
| IUPAC Name | 2-[4-(carboxylatomethyl)-7-(carboxymethyl)-10-[2-[cyclopentyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) |
| SMILES | O=C([O-])CN1CCN(CC(=O)[O-])CCN(CC(=O)N(CC(=O)Oc2ccc([N+](=O)[O-])cc2)C2CCCC2)CCN(CC(=O)O)CC1.[Gd+3] |
| InChI | InChI=1S/C29H42N6O11.Gd/c36-25(34(22-3-1-2-4-22)21-29(43)46-24-7-5-23(6-8-24)35(44)45)17-30-9-11-31(18-26(37)38)13-15-33(20-28(41)42)16-14-32(12-10-30)19-27(39)40;/h5-8,22H,1-4,9-21H2,(H,37,38)(H,39,40)(H,41,42);/q;+3/p-2 |
| InChIKey | MOAFJTZJOFWBJR-UHFFFAOYSA-L |
| XLogP | -2.92 |
| TPSA | 220.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.92 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|