C12H12N2O6 — CID 67520815
(2S)-1-(4-nitrophenoxy)carbonylpyrrolidine-2-carboxylic acid (PubChem CID 67520815) has the molecular formula C12H12N2O6 and a molecular weight of 280.24 g/mol. Its IUPAC name is (2S)-1-(4-nitrophenoxy)carbonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(4-nitrophenoxy)carbonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67520815 |
| Molecular Formula | C12H12N2O6 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | (2S)-1-(4-nitrophenoxy)carbonylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H12N2O6/c15-11(16)10-2-1-7-13(10)12(17)20-9-5-3-8(4-6-9)14(18)19/h3-6,10H,1-2,7H2,(H,15,16)/t10-/m0/s1 |
| InChIKey | RQZRZSYFJCSDQG-JTQLQIEISA-N |
| XLogP | 1.64 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|