C15H17N3O7 — CID 163807631
methyl (2S)-1-[2-[(4-nitrophenoxy)carbonylamino]acetyl]pyrrolidine-2-carboxylate (PubChem CID 163807631) has the molecular formula C15H17N3O7 and a molecular weight of 351.32 g/mol. Its IUPAC name is methyl (2S)-1-[2-[(4-nitrophenoxy)carbonylamino]acetyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[2-[(4-nitrophenoxy)carbonylamino]acetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 163807631 |
| Molecular Formula | C15H17N3O7 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | methyl (2S)-1-[2-[(4-nitrophenoxy)carbonylamino]acetyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)CNC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H17N3O7/c1-24-14(20)12-3-2-8-17(12)13(19)9-16-15(21)25-11-6-4-10(5-7-11)18(22)23/h4-7,12H,2-3,8-9H2,1H3,(H,16,21)/t12-/m0/s1 |
| InChIKey | NKKCJFPKUOIKAU-LBPRGKRZSA-N |
| XLogP | 0.85 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|