C24H26N4O8 — CID 54532108
(2S)-1-[methyl-[(3S)-3-[(4-nitrophenoxy)carbonylamino]-2-oxo-4-phenylbutyl]carbamoyl]pyrrolidine-2-carboxylic acid (PubChem CID 54532108) has the molecular formula C24H26N4O8 and a molecular weight of 498.49 g/mol. Its IUPAC name is (2S)-1-[methyl-[(3S)-3-[(4-nitrophenoxy)carbonylamino]-2-oxo-4-phenylbutyl]carbamoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[methyl-[(3S)-3-[(4-nitrophenoxy)carbonylamino]-2-oxo-4-phenylbutyl]carbamoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54532108 |
| Molecular Formula | C24H26N4O8 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | (2S)-1-[methyl-[(3S)-3-[(4-nitrophenoxy)carbonylamino]-2-oxo-4-phenylbutyl]carbamoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CN(CC(=O)[C@H](Cc1ccccc1)NC(=O)Oc1ccc([N+](=O)[O-])cc1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C24H26N4O8/c1-26(24(33)27-13-5-8-20(27)22(30)31)15-21(29)19(14-16-6-3-2-4-7-16)25-23(32)36-18-11-9-17(10-12-18)28(34)35/h2-4,6-7,9-12,19-20H,5,8,13-15H2,1H3,(H,25,32)(H,30,31)/t19-,20-/m0/s1 |
| InChIKey | YXGPUGNOMOUKDZ-PMACEKPBSA-N |
| XLogP | 2.46 |
| TPSA | 159.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|