C24H25N3O7 — CID 70334364
methyl (2S)-1-[(2S)-2-(2,3-dihydro-1H-inden-2-yl)-2-[(4-nitrophenoxy)carbonylamino]acetyl]pyrrolidine-2-carboxylate (PubChem CID 70334364) has the molecular formula C24H25N3O7 and a molecular weight of 467.48 g/mol. Its IUPAC name is methyl (2S)-1-[(2S)-2-(2,3-dihydro-1H-inden-2-yl)-2-[(4-nitrophenoxy)carbonylamino]acetyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(2S)-2-(2,3-dihydro-1H-inden-2-yl)-2-[(4-nitrophenoxy)carbonylamino]acetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 70334364 |
| Molecular Formula | C24H25N3O7 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | methyl (2S)-1-[(2S)-2-(2,3-dihydro-1H-inden-2-yl)-2-[(4-nitrophenoxy)carbonylamino]acetyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)Oc1ccc([N+](=O)[O-])cc1)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C24H25N3O7/c1-33-23(29)20-7-4-12-26(20)22(28)21(17-13-15-5-2-3-6-16(15)14-17)25-24(30)34-19-10-8-18(9-11-19)27(31)32/h2-3,5-6,8-11,17,20-21H,4,7,12-14H2,1H3,(H,25,30)/t20-,21-/m0/s1 |
| InChIKey | NPRWQVHKNHTIGX-SFTDATJTSA-N |
| XLogP | 2.63 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|