C24H25N3O8 — CID 101044201
4-[(2S)-2-[[(2S)-1-(4-nitrophenoxy)-1-oxo-3-phenylpropan-2-yl]carbamoyl]pyrrolidin-1-yl]-4-oxobutanoic acid (PubChem CID 101044201) has the molecular formula C24H25N3O8 and a molecular weight of 483.48 g/mol. Its IUPAC name is 4-[(2S)-2-[[(2S)-1-(4-nitrophenoxy)-1-oxo-3-phenylpropan-2-yl]carbamoyl]pyrrolidin-1-yl]-4-oxobutanoic acid.
| Compound Name | 4-[(2S)-2-[[(2S)-1-(4-nitrophenoxy)-1-oxo-3-phenylpropan-2-yl]carbamoyl]pyrrolidin-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 101044201 |
| Molecular Formula | C24H25N3O8 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 4-[(2S)-2-[[(2S)-1-(4-nitrophenoxy)-1-oxo-3-phenylpropan-2-yl]carbamoyl]pyrrolidin-1-yl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H25N3O8/c28-21(12-13-22(29)30)26-14-4-7-20(26)23(31)25-19(15-16-5-2-1-3-6-16)24(32)35-18-10-8-17(9-11-18)27(33)34/h1-3,5-6,8-11,19-20H,4,7,12-15H2,(H,25,31)(H,29,30)/t19-,20-/m0/s1 |
| InChIKey | DDQVZBWJSDHNSA-PMACEKPBSA-N |
| XLogP | 2.08 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|