C28H33N3O7 — CID 70543344
tert-butyl (2S)-1-[(5R)-5-benzamido-6-(4-nitrophenyl)-4-oxohexanoyl]pyrrolidine-2-carboxylate (PubChem CID 70543344) has the molecular formula C28H33N3O7 and a molecular weight of 523.59 g/mol. Its IUPAC name is tert-butyl (2S)-1-[(5R)-5-benzamido-6-(4-nitrophenyl)-4-oxohexanoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[(5R)-5-benzamido-6-(4-nitrophenyl)-4-oxohexanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 70543344 |
| Molecular Formula | C28H33N3O7 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | tert-butyl (2S)-1-[(5R)-5-benzamido-6-(4-nitrophenyl)-4-oxohexanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN1C(=O)CCC(=O)[C@@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H33N3O7/c1-28(2,3)38-27(35)23-10-7-17-30(23)25(33)16-15-24(32)22(29-26(34)20-8-5-4-6-9-20)18-19-11-13-21(14-12-19)31(36)37/h4-6,8-9,11-14,22-23H,7,10,15-18H2,1-3H3,(H,29,34)/t22-,23+/m1/s1 |
| InChIKey | KMKCNGSKMUWBGF-PKTZIBPZSA-N |
| XLogP | 3.62 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|