C20H19NO6 — CID 70519317
4-[(2R)-2-benzamido-5-carboxy-3-oxopentyl]benzoic acid (PubChem CID 70519317) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is 4-[(2R)-2-benzamido-5-carboxy-3-oxopentyl]benzoic acid.
| Compound Name | 4-[(2R)-2-benzamido-5-carboxy-3-oxopentyl]benzoic acid |
|---|---|
| PubChem CID | 70519317 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 4-[(2R)-2-benzamido-5-carboxy-3-oxopentyl]benzoic acid |
| SMILES | O=C(O)CCC(=O)[C@@H](Cc1ccc(C(=O)O)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19NO6/c22-17(10-11-18(23)24)16(21-19(25)14-4-2-1-3-5-14)12-13-6-8-15(9-7-13)20(26)27/h1-9,16H,10-12H2,(H,21,25)(H,23,24)(H,26,27)/t16-/m1/s1 |
| InChIKey | IUVWFFIXHBQIMJ-MRXNPFEDSA-N |
| XLogP | 2.16 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |