C28H33NO6 — CID 70079005
3-[1-[(5S)-5-benzamido-4-oxo-6-phenylhexanoyl]oxycyclohexyl]propanoic acid (PubChem CID 70079005) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is 3-[1-[(5S)-5-benzamido-4-oxo-6-phenylhexanoyl]oxycyclohexyl]propanoic acid.
| Compound Name | 3-[1-[(5S)-5-benzamido-4-oxo-6-phenylhexanoyl]oxycyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 70079005 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 3-[1-[(5S)-5-benzamido-4-oxo-6-phenylhexanoyl]oxycyclohexyl]propanoic acid |
| SMILES | O=C(O)CCC1(OC(=O)CCC(=O)[C@H](Cc2ccccc2)NC(=O)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C28H33NO6/c30-24(14-15-26(33)35-28(19-16-25(31)32)17-8-3-9-18-28)23(20-21-10-4-1-5-11-21)29-27(34)22-12-6-2-7-13-22/h1-2,4-7,10-13,23H,3,8-9,14-20H2,(H,29,34)(H,31,32)/t23-/m0/s1 |
| InChIKey | HNZKQUGDZWAFLC-QHCPKHFHSA-N |
| XLogP | 4.49 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |