C25H29N3O4 — CID 88568382
N-[(2S)-1-[[(2S)-1-[(1-formylcyclopentyl)amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide (PubChem CID 88568382) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-1-[(1-formylcyclopentyl)amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-[[(2S)-1-[(1-formylcyclopentyl)amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 88568382 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N-[(2S)-1-[[(2S)-1-[(1-formylcyclopentyl)amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide |
| SMILES | C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1)C(=O)NC1(C=O)CCCC1 |
| InChI | InChI=1S/C25H29N3O4/c1-18(22(30)28-25(17-29)14-8-9-15-25)26-24(32)21(16-19-10-4-2-5-11-19)27-23(31)20-12-6-3-7-13-20/h2-7,10-13,17-18,21H,8-9,14-16H2,1H3,(H,26,32)(H,27,31)(H,28,30)/t18-,21-/m0/s1 |
| InChIKey | ZWGFNJNZLNICFY-RXVVDRJESA-N |
| XLogP | 2.16 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|