C30H38N6O8 — CID 10507954
2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-benzamidopropanoyl]amino]propanoyl]amino]propanoyl]amino]-3-phenylpropanoyl]amino]propanoyl]amino]acetic acid (PubChem CID 10507954) has the molecular formula C30H38N6O8 and a molecular weight of 610.67 g/mol. Its IUPAC name is 2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-benzamidopropanoyl]amino]propanoyl]amino]propanoyl]amino]-3-phenylpropanoyl]amino]propanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-benzamidopropanoyl]amino]propanoyl]amino]propanoyl]amino]-3-phenylpropanoyl]amino]propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 10507954 |
| Molecular Formula | C30H38N6O8 |
| Molecular Weight | 610.67 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | 2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-benzamidopropanoyl]amino]propanoyl]amino]propanoyl]amino]-3-phenylpropanoyl]amino]propanoyl]amino]acetic acid |
| SMILES | C[C@H](NC(=O)c1ccccc1)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C)C(=O)NCC(=O)O |
| InChI | InChI=1S/C30H38N6O8/c1-17(25(39)31-16-24(37)38)35-30(44)23(15-21-11-7-5-8-12-21)36-28(42)20(4)33-26(40)18(2)32-27(41)19(3)34-29(43)22-13-9-6-10-14-22/h5-14,17-20,23H,15-16H2,1-4H3,(H,31,39)(H,32,41)(H,33,40)(H,34,43)(H,35,44)(H,36,42)(H,37,38)/t17-,18-,19-,20-,23-/m0/s1 |
| InChIKey | RIMKAUOTHIGYAZ-LUVDPRQJSA-N |
| XLogP | -0.75 |
| TPSA | 211.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.67 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |