C28H28N2O5S — CID 70519767
thiophen-2-yl (2S)-1-(5-benzamido-4-oxo-6-phenylhexanoyl)pyrrolidine-2-carboxylate (PubChem CID 70519767) has the molecular formula C28H28N2O5S and a molecular weight of 504.61 g/mol. Its IUPAC name is thiophen-2-yl (2S)-1-(5-benzamido-4-oxo-6-phenylhexanoyl)pyrrolidine-2-carboxylate.
| Compound Name | thiophen-2-yl (2S)-1-(5-benzamido-4-oxo-6-phenylhexanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 70519767 |
| Molecular Formula | C28H28N2O5S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | thiophen-2-yl (2S)-1-(5-benzamido-4-oxo-6-phenylhexanoyl)pyrrolidine-2-carboxylate |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)CCC(=O)N1CCC[C@H]1C(=O)Oc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C28H28N2O5S/c31-24(15-16-25(32)30-17-7-13-23(30)28(34)35-26-14-8-18-36-26)22(19-20-9-3-1-4-10-20)29-27(33)21-11-5-2-6-12-21/h1-6,8-12,14,18,22-23H,7,13,15-17,19H2,(H,29,33)/t22?,23-/m0/s1 |
| InChIKey | XSTNOJYPJMSFJE-WCSIJFPASA-N |
| XLogP | 4.04 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |