C35H46N2O6 — CID 70080520
adamantan-1-amine;2-[(5S)-5-benzamido-4-oxo-6-phenylhexanoyl]oxyhexanoic acid (PubChem CID 70080520) has the molecular formula C35H46N2O6 and a molecular weight of 590.76 g/mol. Its IUPAC name is adamantan-1-amine;2-[(5S)-5-benzamido-4-oxo-6-phenylhexanoyl]oxyhexanoic acid.
| Compound Name | adamantan-1-amine;2-[(5S)-5-benzamido-4-oxo-6-phenylhexanoyl]oxyhexanoic acid |
|---|---|
| PubChem CID | 70080520 |
| Molecular Formula | C35H46N2O6 |
| Molecular Weight | 590.76 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | adamantan-1-amine;2-[(5S)-5-benzamido-4-oxo-6-phenylhexanoyl]oxyhexanoic acid |
| SMILES | CCCCC(OC(=O)CCC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1)C(=O)O.NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H29NO6.C10H17N/c1-2-3-14-22(25(30)31)32-23(28)16-15-21(27)20(17-18-10-6-4-7-11-18)26-24(29)19-12-8-5-9-13-19;11-10-4-7-1-8(5-10)3-9(2-7)6-10/h4-13,20,22H,2-3,14-17H2,1H3,(H,26,29)(H,30,31);7-9H,1-6,11H2/t20-,22?;/m0./s1 |
| InChIKey | IVURPQJIZUIVHD-CNAJMHLNSA-N |
| XLogP | 5.48 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.76 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |