C17H13F3N2O5 — CID 154191344
(4-nitrophenyl) (2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 154191344) has the molecular formula C17H13F3N2O5 and a molecular weight of 382.29 g/mol. Its IUPAC name is (4-nitrophenyl) (2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | (4-nitrophenyl) (2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 154191344 |
| Molecular Formula | C17H13F3N2O5 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | (4-nitrophenyl) (2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)[C@H](Cc1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H13F3N2O5/c18-17(19,20)16(24)21-14(10-11-4-2-1-3-5-11)15(23)27-13-8-6-12(7-9-13)22(25)26/h1-9,14H,10H2,(H,21,24)/t14-/m0/s1 |
| InChIKey | SLILVYQURBFJIA-AWEZNQCLSA-N |
| XLogP | 2.79 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|