About bis(4-nitrophenyl) (2R)-2-benzylbutanedioate
bis(4-nitrophenyl) (2R)-2-benzylbutanedioate (PubChem CID 15816859) has the molecular formula C23H18N2O8
and a molecular weight of 450.40 g/mol. Its IUPAC name is bis(4-nitrophenyl) (2R)-2-benzylbutanedioate.
Molecular Properties
| Compound Name | bis(4-nitrophenyl) (2R)-2-benzylbutanedioate |
| PubChem CID | 15816859 |
| Molecular Formula | C23H18N2O8 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | bis(4-nitrophenyl) (2R)-2-benzylbutanedioate |
| SMILES | O=C(C[C@@H](Cc1ccccc1)C(=O)Oc1ccc([N+](=O)[O-])cc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H18N2O8/c26-22(32-20-10-6-18(7-11-20)24(28)29)15-17(14-16-4-2-1-3-5-16)23(27)33-21-12-8-19(9-13-21)25(30)31/h1-13,17H,14-15H2/t17-/m1/s1 |
| InChIKey | JDFPIMQCJCPHCP-QGZVFWFLSA-N |
| XLogP | 4.26 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis(4-nitrophenyl) (2R)-2-benzylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-nitrophenyl) (2R)-2-benzylbutanedioate?
The IUPAC name of bis(4-nitrophenyl) (2R)-2-benzylbutanedioate (CID 15816859) is bis(4-nitrophenyl) (2R)-2-benzylbutanedioate.
What is the SMILES notation for bis(4-nitrophenyl) (2R)-2-benzylbutanedioate?
The canonical SMILES for bis(4-nitrophenyl) (2R)-2-benzylbutanedioate is O=C(C[C@@H](Cc1ccccc1)C(=O)Oc1ccc([N+](=O)[O-])cc1)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of bis(4-nitrophenyl) (2R)-2-benzylbutanedioate?
The InChIKey is JDFPIMQCJCPHCP-QGZVFWFLSA-N. The full InChI is InChI=1S/C23H18N2O8/c26-22(32-20-10-6-18(7-11-20)24(28)29)15-17(14-16-4-2-1-3-5-16)23(27)33-21-12-8-19(9-13-21)25(30)31/h1-13,17H,14-15H2/t17-/m1/s1.
What are the key properties of bis(4-nitrophenyl) (2R)-2-benzylbutanedioate?
bis(4-nitrophenyl) (2R)-2-benzylbutanedioate has a molecular weight of 450.40 g/mol, XLogP of 4.26, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-nitrophenyl) (2R)-2-benzylbutanedioate is sourced from PubChem (CID 15816859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).