About 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-benzylbutanedioate
1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-benzylbutanedioate (PubChem CID 159846227) has the molecular formula C26H25NO6
and a molecular weight of 447.49 g/mol. Its IUPAC name is 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-benzylbutanedioate.
Molecular Properties
| Compound Name | 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-benzylbutanedioate |
| PubChem CID | 159846227 |
| Molecular Formula | C26H25NO6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-benzylbutanedioate |
| SMILES | O=C(CC(Cc1ccccc1)C(=O)OCCNC(=O)Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C26H25NO6/c28-24(32-22-12-6-2-7-13-22)19-21(18-20-10-4-1-5-11-20)25(29)31-17-16-27-26(30)33-23-14-8-3-9-15-23/h1-15,21H,16-19H2,(H,27,30) |
| InChIKey | NPIKOKYHWCFEEP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-benzylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-benzylbutanedioate?
The IUPAC name of 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-benzylbutanedioate (CID 159846227) is 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-benzylbutanedioate.
What is the SMILES notation for 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-benzylbutanedioate?
The canonical SMILES for 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-benzylbutanedioate is O=C(CC(Cc1ccccc1)C(=O)OCCNC(=O)Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-benzylbutanedioate?
The InChIKey is NPIKOKYHWCFEEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25NO6/c28-24(32-22-12-6-2-7-13-22)19-21(18-20-10-4-1-5-11-20)25(29)31-17-16-27-26(30)33-23-14-8-3-9-15-23/h1-15,21H,16-19H2,(H,27,30).
What are the key properties of 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-benzylbutanedioate?
1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-benzylbutanedioate has a molecular weight of 447.49 g/mol, XLogP of 4.17, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[2-(phenoxycarbonylamino)ethyl] 4-O-phenyl 2-benzylbutanedioate is sourced from PubChem (CID 159846227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).